C21H13N3O6 — CID 46682221
(1,3-dioxoisoindol-2-yl)methyl 6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 46682221) has the molecular formula C21H13N3O6 and a molecular weight of 403.35 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 46682221 |
| Molecular Formula | C21H13N3O6 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 6-(furan-2-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1noc2nc(-c3ccco3)cc(C(=O)OCN3C(=O)c4ccccc4C3=O)c12 |
| InChI | InChI=1S/C21H13N3O6/c1-11-17-14(9-15(16-7-4-8-28-16)22-18(17)30-23-11)21(27)29-10-24-19(25)12-5-2-3-6-13(12)20(24)26/h2-9H,10H2,1H3 |
| InChIKey | WNZFYSDDHSNLIV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 115.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|