C19H21Cl2N3O2 — CID 119375996
(4-aminopiperidin-1-yl)-[2-(furan-2-yl)quinolin-4-yl]methanone;dihydrochloride (PubChem CID 119375996) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[2-(furan-2-yl)quinolin-4-yl]methanone;dihydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-[2-(furan-2-yl)quinolin-4-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119375996 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[2-(furan-2-yl)quinolin-4-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(C(=O)c2cc(-c3ccco3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C19H19N3O2.2ClH/c20-13-7-9-22(10-8-13)19(23)15-12-17(18-6-3-11-24-18)21-16-5-2-1-4-14(15)16;;/h1-6,11-13H,7-10,20H2;2*1H |
| InChIKey | YYVQCBBLFBFECD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |