C18H23Cl2N3O — CID 119374525
(4-aminopiperidin-1-yl)-(2-cyclopropylquinolin-4-yl)methanone;dihydrochloride (PubChem CID 119374525) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(2-cyclopropylquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-(2-cyclopropylquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119374525 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(2-cyclopropylquinolin-4-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(C(=O)c2cc(C3CC3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C18H21N3O.2ClH/c19-13-7-9-21(10-8-13)18(22)15-11-17(12-5-6-12)20-16-4-2-1-3-14(15)16;;/h1-4,11-13H,5-10,19H2;2*1H |
| InChIKey | KPTGJURHYYXOEQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |