C28H27N3O3 — CID 55596344
1-[4-[2-(furan-2-yl)quinoline-4-carbonyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one (PubChem CID 55596344) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-[4-[2-(furan-2-yl)quinoline-4-carbonyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one.
| Compound Name | 1-[4-[2-(furan-2-yl)quinoline-4-carbonyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 55596344 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-[4-[2-(furan-2-yl)quinoline-4-carbonyl]piperazin-1-yl]-2-methyl-2-phenylpropan-1-one |
| SMILES | CC(C)(C(=O)N1CCN(C(=O)c2cc(-c3ccco3)nc3ccccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O3/c1-28(2,20-9-4-3-5-10-20)27(33)31-16-14-30(15-17-31)26(32)22-19-24(25-13-8-18-34-25)29-23-12-7-6-11-21(22)23/h3-13,18-19H,14-17H2,1-2H3 |
| InChIKey | GIRAUCKFPKHPRE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |