C23H23N3O5 — CID 7132339
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 6-methoxy-2-phenylquinoline-4-carboxylate (PubChem CID 7132339) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 6-methoxy-2-phenylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 6-methoxy-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7132339 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 6-methoxy-2-phenylquinoline-4-carboxylate |
| SMILES | COc1ccc2nc(-c3ccccc3)cc(C(=O)OCC(=O)NC(=O)NC(C)C)c2c1 |
| InChI | InChI=1S/C23H23N3O5/c1-14(2)24-23(29)26-21(27)13-31-22(28)18-12-20(15-7-5-4-6-8-15)25-19-10-9-16(30-3)11-17(18)19/h4-12,14H,13H2,1-3H3,(H2,24,26,27,29) |
| InChIKey | KMIFMKOWATVEEY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |