C26H23N3O4 — CID 154772613
furan-2-yl-[4-(6-methoxy-2-phenylquinoline-4-carbonyl)piperazin-1-yl]methanone (PubChem CID 154772613) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is furan-2-yl-[4-(6-methoxy-2-phenylquinoline-4-carbonyl)piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-(6-methoxy-2-phenylquinoline-4-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 154772613 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | furan-2-yl-[4-(6-methoxy-2-phenylquinoline-4-carbonyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc2nc(-c3ccccc3)cc(C(=O)N3CCN(C(=O)c4ccco4)CC3)c2c1 |
| InChI | InChI=1S/C26H23N3O4/c1-32-19-9-10-22-20(16-19)21(17-23(27-22)18-6-3-2-4-7-18)25(30)28-11-13-29(14-12-28)26(31)24-8-5-15-33-24/h2-10,15-17H,11-14H2,1H3 |
| InChIKey | IAWUMJRSLUVWMO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |