C17H17FN2O4 — CID 38910645
(2-fluoro-4-methoxyphenyl)-[4-(furan-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 38910645) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl)-[4-(furan-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (2-fluoro-4-methoxyphenyl)-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38910645 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl)-[4-(furan-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)c3ccco3)CC2)c(F)c1 |
| InChI | InChI=1S/C17H17FN2O4/c1-23-12-4-5-13(14(18)11-12)16(21)19-6-8-20(9-7-19)17(22)15-3-2-10-24-15/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | HCKWDBCTCAZDST-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |