C15H15FN2O4 — CID 86920882
N-[2-[(2-fluoro-4-methoxybenzoyl)amino]ethyl]furan-2-carboxamide (PubChem CID 86920882) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is N-[2-[(2-fluoro-4-methoxybenzoyl)amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2-fluoro-4-methoxybenzoyl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86920882 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[2-[(2-fluoro-4-methoxybenzoyl)amino]ethyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)c2ccco2)c(F)c1 |
| InChI | InChI=1S/C15H15FN2O4/c1-21-10-4-5-11(12(16)9-10)14(19)17-6-7-18-15(20)13-3-2-8-22-13/h2-5,8-9H,6-7H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | UWIIFDHQVXBQDC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|