C17H20N2O5 — CID 24683474
N-[2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]ethyl]furan-2-carboxamide (PubChem CID 24683474) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24683474 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]ethyl]furan-2-carboxamide |
| SMILES | COc1ccc(CC(=O)NCCNC(=O)c2ccco2)c(OC)c1 |
| InChI | InChI=1S/C17H20N2O5/c1-22-13-6-5-12(15(11-13)23-2)10-16(20)18-7-8-19-17(21)14-4-3-9-24-14/h3-6,9,11H,7-8,10H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | SCJFFSMYEASZLD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|