C17H25FN4O4S — CID 55653073
(2-fluoro-4-methoxyphenyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55653073) has the molecular formula C17H25FN4O4S and a molecular weight of 400.48 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2-fluoro-4-methoxyphenyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55653073 |
| Molecular Formula | C17H25FN4O4S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl)-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(S(=O)(=O)N3CCN(C)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C17H25FN4O4S/c1-19-5-9-21(10-6-19)27(24,25)22-11-7-20(8-12-22)17(23)15-4-3-14(26-2)13-16(15)18/h3-4,13H,5-12H2,1-2H3 |
| InChIKey | IBOKZDPOVHMCRF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |