C18H19N3O5 — CID 108502696
2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide (PubChem CID 108502696) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108502696 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C18H19N3O5/c1-25-14-6-4-13(5-7-14)19-16(22)18(24)21-10-8-20(9-11-21)17(23)15-3-2-12-26-15/h2-7,12H,8-11H2,1H3,(H,19,22) |
| InChIKey | FTFOLYCDUHCLJU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|