C20H25N4O5+ — CID 7405790
N-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl]-N'-(4-methoxyphenyl)oxamide (PubChem CID 7405790) has the molecular formula C20H25N4O5+ and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl]-N'-(4-methoxyphenyl)oxamide.
| Compound Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl]-N'-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 7405790 |
| Molecular Formula | C20H25N4O5+ |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl]-N'-(4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCC[NH+]2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O5/c1-28-16-6-4-15(5-7-16)22-19(26)18(25)21-8-9-23-10-12-24(13-11-23)20(27)17-3-2-14-29-17/h2-7,14H,8-13H2,1H3,(H,21,25)(H,22,26)/p+1 |
| InChIKey | BDNFJWLDHHXALI-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|