C22H28N5O3+ — CID 7182649
N'-(4-methylphenyl)-N-[2-[4-(phenylcarbamoyl)piperazin-1-ium-1-yl]ethyl]oxamide (PubChem CID 7182649) has the molecular formula C22H28N5O3+ and a molecular weight of 410.50 g/mol. Its IUPAC name is N'-(4-methylphenyl)-N-[2-[4-(phenylcarbamoyl)piperazin-1-ium-1-yl]ethyl]oxamide.
| Compound Name | N'-(4-methylphenyl)-N-[2-[4-(phenylcarbamoyl)piperazin-1-ium-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 7182649 |
| Molecular Formula | C22H28N5O3+ |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N'-(4-methylphenyl)-N-[2-[4-(phenylcarbamoyl)piperazin-1-ium-1-yl]ethyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC[NH+]2CCN(C(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N5O3/c1-17-7-9-19(10-8-17)24-21(29)20(28)23-11-12-26-13-15-27(16-14-26)22(30)25-18-5-3-2-4-6-18/h2-10H,11-16H2,1H3,(H,23,28)(H,24,29)(H,25,30)/p+1 |
| InChIKey | LVOCSHWKVHERTP-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|