C14H20N4O2 — CID 23990210
1-N-methyl-4-N-(4-methylphenyl)piperazine-1,4-dicarboxamide (PubChem CID 23990210) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-N-methyl-4-N-(4-methylphenyl)piperazine-1,4-dicarboxamide.
| Compound Name | 1-N-methyl-4-N-(4-methylphenyl)piperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 23990210 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-N-methyl-4-N-(4-methylphenyl)piperazine-1,4-dicarboxamide |
| SMILES | CNC(=O)N1CCN(C(=O)Nc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C14H20N4O2/c1-11-3-5-12(6-4-11)16-14(20)18-9-7-17(8-10-18)13(19)15-2/h3-6H,7-10H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | WZTFEZGKMKXDHR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |