C15H22N4O3 — CID 23800038
1-N-(4-methoxyphenyl)-4-N-methyl-1,4-diazepane-1,4-dicarboxamide (PubChem CID 23800038) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-N-(4-methoxyphenyl)-4-N-methyl-1,4-diazepane-1,4-dicarboxamide.
| Compound Name | 1-N-(4-methoxyphenyl)-4-N-methyl-1,4-diazepane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 23800038 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-N-(4-methoxyphenyl)-4-N-methyl-1,4-diazepane-1,4-dicarboxamide |
| SMILES | CNC(=O)N1CCCN(C(=O)Nc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-16-14(20)18-8-3-9-19(11-10-18)15(21)17-12-4-6-13(22-2)7-5-12/h4-7H,3,8-11H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | TVTMGFWEFMLHDF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |