C17H27N3O2 — CID 144843106
N-(4-methoxyphenyl)-1,6-diazacycloundecane-1-carboxamide (PubChem CID 144843106) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,6-diazacycloundecane-1-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-1,6-diazacycloundecane-1-carboxamide |
|---|---|
| PubChem CID | 144843106 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-(4-methoxyphenyl)-1,6-diazacycloundecane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCCCCNCCCC2)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-22-16-9-7-15(8-10-16)19-17(21)20-13-5-2-3-11-18-12-4-6-14-20/h7-10,18H,2-6,11-14H2,1H3,(H,19,21) |
| InChIKey | UFOCAAAKLVBKMO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |