C17H27N3O4 — CID 174768397
tert-butyl formate;N-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 174768397) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl formate;N-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | tert-butyl formate;N-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 174768397 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl formate;N-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)OC=O.COc1ccc(NC(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C12H17N3O2.C5H10O2/c1-17-11-4-2-10(3-5-11)14-12(16)15-8-6-13-7-9-15;1-5(2,3)7-4-6/h2-5,13H,6-9H2,1H3,(H,14,16);4H,1-3H3 |
| InChIKey | AEUQJBSAJMLFMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|