C33H44N4O2 — CID 144843104
N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;N-methylethanamine;2-phenylethynylbenzene (PubChem CID 144843104) has the molecular formula C33H44N4O2 and a molecular weight of 528.74 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;N-methylethanamine;2-phenylethynylbenzene.
| Compound Name | N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;N-methylethanamine;2-phenylethynylbenzene |
|---|---|
| PubChem CID | 144843104 |
| Molecular Formula | C33H44N4O2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;N-methylethanamine;2-phenylethynylbenzene |
| SMILES | C(#Cc1ccccc1)c1ccccc1.CCNC.COc1ccc(NC(=O)N2CCCCNCCCC2)cc1 |
| InChI | InChI=1S/C16H25N3O2.C14H10.C3H9N/c1-21-15-8-6-14(7-9-15)18-16(20)19-12-4-2-10-17-11-3-5-13-19;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-4-2/h6-9,17H,2-5,10-13H2,1H3,(H,18,20);1-10H;4H,3H2,1-2H3 |
| InChIKey | APKQNMYLQDKLCK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|