C31H39N3O3 — CID 144843117
methanol;N-(3-methoxyphenyl)-1,6-diazecane-1-carboxamide;2-phenylethynylbenzene (PubChem CID 144843117) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is methanol;N-(3-methoxyphenyl)-1,6-diazecane-1-carboxamide;2-phenylethynylbenzene.
| Compound Name | methanol;N-(3-methoxyphenyl)-1,6-diazecane-1-carboxamide;2-phenylethynylbenzene |
|---|---|
| PubChem CID | 144843117 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | methanol;N-(3-methoxyphenyl)-1,6-diazecane-1-carboxamide;2-phenylethynylbenzene |
| SMILES | C(#Cc1ccccc1)c1ccccc1.CO.COc1cccc(NC(=O)N2CCCCNCCCC2)c1 |
| InChI | InChI=1S/C16H25N3O2.C14H10.CH4O/c1-21-15-8-6-7-14(13-15)18-16(20)19-11-4-2-9-17-10-3-5-12-19;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2/h6-8,13,17H,2-5,9-12H2,1H3,(H,18,20);1-10H;2H,1H3 |
| InChIKey | BRSCYYQOSMIPOI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|