C26H38N6O4 — CID 159106714
1-isocyanato-3-methoxybenzene;N-(3-methoxyphenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine (PubChem CID 159106714) has the molecular formula C26H38N6O4 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-isocyanato-3-methoxybenzene;N-(3-methoxyphenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine.
| Compound Name | 1-isocyanato-3-methoxybenzene;N-(3-methoxyphenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine |
|---|---|
| PubChem CID | 159106714 |
| Molecular Formula | C26H38N6O4 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 1-isocyanato-3-methoxybenzene;N-(3-methoxyphenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine |
| SMILES | CN1CCNCC1.COc1cccc(N=C=O)c1.COc1cccc(NC(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C13H19N3O2.C8H7NO2.C5H12N2/c1-15-6-8-16(9-7-15)13(17)14-11-4-3-5-12(10-11)18-2;1-11-8-4-2-3-7(5-8)9-6-10;1-7-4-2-6-3-5-7/h3-5,10H,6-9H2,1-2H3,(H,14,17);2-5H,1H3;6H,2-5H2,1H3 |
| InChIKey | KDZAUGZBMOUMQY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|