C26H36Cl2N6O2 — CID 161431081
1-chloro-3-isocyanatobenzene;N-(3-chlorophenyl)-4-ethylpiperazine-1-carboxamide;1-ethylpiperazine (PubChem CID 161431081) has the molecular formula C26H36Cl2N6O2 and a molecular weight of 535.52 g/mol. Its IUPAC name is 1-chloro-3-isocyanatobenzene;N-(3-chlorophenyl)-4-ethylpiperazine-1-carboxamide;1-ethylpiperazine.
| Compound Name | 1-chloro-3-isocyanatobenzene;N-(3-chlorophenyl)-4-ethylpiperazine-1-carboxamide;1-ethylpiperazine |
|---|---|
| PubChem CID | 161431081 |
| Molecular Formula | C26H36Cl2N6O2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 1-chloro-3-isocyanatobenzene;N-(3-chlorophenyl)-4-ethylpiperazine-1-carboxamide;1-ethylpiperazine |
| SMILES | CCN1CCN(C(=O)Nc2cccc(Cl)c2)CC1.CCN1CCNCC1.O=C=Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O.C7H4ClNO.C6H14N2/c1-2-16-6-8-17(9-7-16)13(18)15-12-5-3-4-11(14)10-12;8-6-2-1-3-7(4-6)9-5-10;1-2-8-5-3-7-4-6-8/h3-5,10H,2,6-9H2,1H3,(H,15,18);1-4H;7H,2-6H2,1H3 |
| InChIKey | VYACQJLGAXNQPB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|