C13H17ClN4O2 — CID 23932887
4-N-(3-chlorophenyl)-1-N-methylpiperazine-1,4-dicarboxamide (PubChem CID 23932887) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-1-N-methylpiperazine-1,4-dicarboxamide.
| Compound Name | 4-N-(3-chlorophenyl)-1-N-methylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 23932887 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-N-(3-chlorophenyl)-1-N-methylpiperazine-1,4-dicarboxamide |
| SMILES | CNC(=O)N1CCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-15-12(19)17-5-7-18(8-6-17)13(20)16-11-4-2-3-10(14)9-11/h2-4,9H,5-8H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | ZZSWFQQFMWPNLJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |