C15H18ClN3O4 — CID 154873717
methyl 3-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]-3-oxopropanoate (PubChem CID 154873717) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is methyl 3-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 154873717 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | methyl 3-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)N1CCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18ClN3O4/c1-23-14(21)10-13(20)18-5-7-19(8-6-18)15(22)17-12-4-2-3-11(16)9-12/h2-4,9H,5-8,10H2,1H3,(H,17,22) |
| InChIKey | SLOZWQBFURILDZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|