C24H32F2N6O2 — CID 158619249
1-fluoro-3-isocyanatobenzene;N-(3-fluorophenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine (PubChem CID 158619249) has the molecular formula C24H32F2N6O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-fluoro-3-isocyanatobenzene;N-(3-fluorophenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine.
| Compound Name | 1-fluoro-3-isocyanatobenzene;N-(3-fluorophenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine |
|---|---|
| PubChem CID | 158619249 |
| Molecular Formula | C24H32F2N6O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 1-fluoro-3-isocyanatobenzene;N-(3-fluorophenyl)-4-methylpiperazine-1-carboxamide;1-methylpiperazine |
| SMILES | CN1CCN(C(=O)Nc2cccc(F)c2)CC1.CN1CCNCC1.O=C=Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H16FN3O.C7H4FNO.C5H12N2/c1-15-5-7-16(8-6-15)12(17)14-11-4-2-3-10(13)9-11;8-6-2-1-3-7(4-6)9-5-10;1-7-4-2-6-3-5-7/h2-4,9H,5-8H2,1H3,(H,14,17);1-4H;6H,2-5H2,1H3 |
| InChIKey | HXUBQIZCTRBHPI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|