C12H18N4O4S — CID 61321561
N-(3-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide (PubChem CID 61321561) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 61321561 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-(3-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCN(S(N)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C12H18N4O4S/c1-20-11-4-2-3-10(9-11)14-12(17)15-5-7-16(8-6-15)21(13,18)19/h2-4,9H,5-8H2,1H3,(H,14,17)(H2,13,18,19) |
| InChIKey | INVRVAXRSDFDSZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |