C28H38N4O3 — CID 144843100
methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;4-phenylpyridine (PubChem CID 144843100) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;4-phenylpyridine.
| Compound Name | methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;4-phenylpyridine |
|---|---|
| PubChem CID | 144843100 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide;4-phenylpyridine |
| SMILES | CO.COc1ccc(NC(=O)N2CCCCNCCCC2)cc1.c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C16H25N3O2.C11H9N.CH4O/c1-21-15-8-6-14(7-9-15)18-16(20)19-12-4-2-10-17-11-3-5-13-19;1-2-4-10(5-3-1)11-6-8-12-9-7-11;1-2/h6-9,17H,2-5,10-13H2,1H3,(H,18,20);1-9H;2H,1H3 |
| InChIKey | YVOZPHRZMUBYBL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |