C33H42N4O3 — CID 144843125
1,3-diphenylpyrrole;methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide (PubChem CID 144843125) has the molecular formula C33H42N4O3 and a molecular weight of 542.72 g/mol. Its IUPAC name is 1,3-diphenylpyrrole;methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide.
| Compound Name | 1,3-diphenylpyrrole;methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide |
|---|---|
| PubChem CID | 144843125 |
| Molecular Formula | C33H42N4O3 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 1,3-diphenylpyrrole;methanol;N-(4-methoxyphenyl)-1,6-diazecane-1-carboxamide |
| SMILES | CO.COc1ccc(NC(=O)N2CCCCNCCCC2)cc1.c1ccc(-c2ccn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C16H25N3O2.C16H13N.CH4O/c1-21-15-8-6-14(7-9-15)18-16(20)19-12-4-2-10-17-11-3-5-13-19;1-3-7-14(8-4-1)15-11-12-17(13-15)16-9-5-2-6-10-16;1-2/h6-9,17H,2-5,10-13H2,1H3,(H,18,20);1-13H;2H,1H3 |
| InChIKey | HYGQEFOIEGDFCL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |