C20H24N4O2 — CID 4055899
1-N,4-N-bis(4-methylphenyl)piperazine-1,4-dicarboxamide (PubChem CID 4055899) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-N,4-N-bis(4-methylphenyl)piperazine-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(4-methylphenyl)piperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4055899 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-N,4-N-bis(4-methylphenyl)piperazine-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(C(=O)Nc3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-15-3-7-17(8-4-15)21-19(25)23-11-13-24(14-12-23)20(26)22-18-9-5-16(2)6-10-18/h3-10H,11-14H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | WDTQLUJPEWRMRU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |