C16H21N3O3 — CID 97247477
N-(4-methylphenyl)-4-[(2R)-oxetane-2-carbonyl]piperazine-1-carboxamide (PubChem CID 97247477) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-[(2R)-oxetane-2-carbonyl]piperazine-1-carboxamide.
| Compound Name | N-(4-methylphenyl)-4-[(2R)-oxetane-2-carbonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 97247477 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-(4-methylphenyl)-4-[(2R)-oxetane-2-carbonyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(C(=O)[C@H]3CCO3)CC2)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-12-2-4-13(5-3-12)17-16(21)19-9-7-18(8-10-19)15(20)14-6-11-22-14/h2-5,14H,6-11H2,1H3,(H,17,21)/t14-/m1/s1 |
| InChIKey | XYVOIKCPAQRTJF-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |