C14H21ClN3O+ — CID 9166248
N-(4-chlorophenyl)-4-propylpiperazin-4-ium-1-carboxamide (PubChem CID 9166248) has the molecular formula C14H21ClN3O+ and a molecular weight of 282.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-propylpiperazin-4-ium-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-propylpiperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 9166248 |
| Molecular Formula | C14H21ClN3O+ |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(4-chlorophenyl)-4-propylpiperazin-4-ium-1-carboxamide |
| SMILES | CCC[NH+]1CCN(C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H20ClN3O/c1-2-7-17-8-10-18(11-9-17)14(19)16-13-5-3-12(15)4-6-13/h3-6H,2,7-11H2,1H3,(H,16,19)/p+1 |
| InChIKey | FTSJCDIDYWZFGE-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |