C15H24N3O2+ — CID 7165091
N-(4-ethoxyphenyl)-4-ethylpiperazin-4-ium-1-carboxamide (PubChem CID 7165091) has the molecular formula C15H24N3O2+ and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-ethylpiperazin-4-ium-1-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-4-ethylpiperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 7165091 |
| Molecular Formula | C15H24N3O2+ |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-ethylpiperazin-4-ium-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)N2CC[NH+](CC)CC2)cc1 |
| InChI | InChI=1S/C15H23N3O2/c1-3-17-9-11-18(12-10-17)15(19)16-13-5-7-14(8-6-13)20-4-2/h5-8H,3-4,9-12H2,1-2H3,(H,16,19)/p+1 |
| InChIKey | VFZSTTTZKDFCQO-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |