C14H20ClN3O3S — CID 47812768
N-(4-chlorophenyl)-4-ethylsulfonyl-1,4-diazepane-1-carboxamide (PubChem CID 47812768) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-ethylsulfonyl-1,4-diazepane-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-ethylsulfonyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 47812768 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(4-chlorophenyl)-4-ethylsulfonyl-1,4-diazepane-1-carboxamide |
| SMILES | CCS(=O)(=O)N1CCCN(C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H20ClN3O3S/c1-2-22(20,21)18-9-3-8-17(10-11-18)14(19)16-13-6-4-12(15)5-7-13/h4-7H,2-3,8-11H2,1H3,(H,16,19) |
| InChIKey | JTUOOLGLFCDOOH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |