C18H16N4O4S — CID 108527865
[4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108527865) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is [4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108527865 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [4-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)C(=O)N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C18H16N4O4S/c19-12-27-14-5-3-13(4-6-14)20-16(23)18(25)22-9-7-21(8-10-22)17(24)15-2-1-11-26-15/h1-6,11H,7-10H2,(H,20,23) |
| InChIKey | MRAFQMRQIZGYCQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|