C13H16ClN3O4 — CID 108514040
N-(2-chloroethyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108514040) has the molecular formula C13H16ClN3O4 and a molecular weight of 313.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(2-chloroethyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108514040 |
| Molecular Formula | C13H16ClN3O4 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-(2-chloroethyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | O=C(NCCCl)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C13H16ClN3O4/c14-3-4-15-11(18)13(20)17-7-5-16(6-8-17)12(19)10-2-1-9-21-10/h1-2,9H,3-8H2,(H,15,18) |
| InChIKey | BLNGSVYTAZIXGC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|