C18H25N3O4 — CID 108530988
N-cycloheptyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108530988) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-cycloheptyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-cycloheptyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108530988 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-cycloheptyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | O=C(NC1CCCCCC1)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H25N3O4/c22-16(19-14-6-3-1-2-4-7-14)18(24)21-11-9-20(10-12-21)17(23)15-8-5-13-25-15/h5,8,13-14H,1-4,6-7,9-12H2,(H,19,22) |
| InChIKey | QUOZWGSDASAJQK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|