C15H22N4O2 — CID 119153283
N-cyclobutyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 119153283) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-cyclobutyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-cyclobutyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119153283 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-cyclobutyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NC1CCC1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-16-15(17-12-4-2-5-12)19-9-7-18(8-10-19)14(20)13-6-3-11-21-13/h3,6,11-12H,2,4-5,7-10H2,1H3,(H,16,17) |
| InChIKey | NZHJTACWFIIWIB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|