C15H25IN4O2 — CID 111166854
N-butyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111166854) has the molecular formula C15H25IN4O2 and a molecular weight of 420.30 g/mol. Its IUPAC name is N-butyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-butyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111166854 |
| Molecular Formula | C15H25IN4O2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-butyl-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCCN/C(=N\C)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C15H24N4O2.HI/c1-3-4-7-17-15(16-2)19-10-8-18(9-11-19)14(20)13-6-5-12-21-13;/h5-6,12H,3-4,7-11H2,1-2H3,(H,16,17);1H |
| InChIKey | JNUWODSWHGUJAU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|