C17H25N5O4 — CID 108518065
1-[4-(2-aminoethyl)piperazin-1-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 108518065) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-[4-(2-aminoethyl)piperazin-1-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-(2-aminoethyl)piperazin-1-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 108518065 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[4-(2-aminoethyl)piperazin-1-yl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | NCCN1CCN(C(=O)C(=O)N2CCN(C(=O)c3ccco3)CC2)CC1 |
| InChI | InChI=1S/C17H25N5O4/c18-3-4-19-5-7-21(8-6-19)16(24)17(25)22-11-9-20(10-12-22)15(23)14-2-1-13-26-14/h1-2,13H,3-12,18H2 |
| InChIKey | VDVLSADGDBVLPF-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|