C15H21N3O4 — CID 70416273
2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl (Z)-3-aminobut-2-enoate (PubChem CID 70416273) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl (Z)-3-aminobut-2-enoate.
| Compound Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl (Z)-3-aminobut-2-enoate |
|---|---|
| PubChem CID | 70416273 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl (Z)-3-aminobut-2-enoate |
| SMILES | C/C(N)=C/C(=O)OCCN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C15H21N3O4/c1-12(16)11-14(19)22-10-8-17-4-6-18(7-5-17)15(20)13-3-2-9-21-13/h2-3,9,11H,4-8,10,16H2,1H3/b12-11- |
| InChIKey | JVYMXJHJQDWPNR-QXMHVHEDSA-N |
| XLogP | 0.44 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|