C19H15ClN2O3 — CID 2380079
(2-amino-2-oxoethyl) 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate (PubChem CID 2380079) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2380079 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc2ccccc2c1C(=O)OCC(N)=O |
| InChI | InChI=1S/C19H15ClN2O3/c1-11-17(19(24)25-10-16(21)23)14-7-2-3-8-15(14)22-18(11)12-5-4-6-13(20)9-12/h2-9H,10H2,1H3,(H2,21,23) |
| InChIKey | VYGMJVRINSYMQE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |