C25H19ClFNO3 — CID 2410604
2-(2-fluorophenoxy)ethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate (PubChem CID 2410604) has the molecular formula C25H19ClFNO3 and a molecular weight of 435.88 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2410604 |
| Molecular Formula | C25H19ClFNO3 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc2ccccc2c1C(=O)OCCOc1ccccc1F |
| InChI | InChI=1S/C25H19ClFNO3/c1-16-23(25(29)31-14-13-30-22-12-5-3-10-20(22)27)19-9-2-4-11-21(19)28-24(16)17-7-6-8-18(26)15-17/h2-12,15H,13-14H2,1H3 |
| InChIKey | HHDRLSWIAKCUTP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|