C23H23ClN2O3 — CID 2580492
[2-(diethylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate (PubChem CID 2580492) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2580492 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
| SMILES | CCN(CC)C(=O)COC(=O)c1c(C)c(-c2cccc(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C23H23ClN2O3/c1-4-26(5-2)20(27)14-29-23(28)21-15(3)22(16-9-8-10-17(24)13-16)25-19-12-7-6-11-18(19)21/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | UEFSEJRAOMJBAT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |