C28H20N4O3 — CID 135765570
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 135765570) has the molecular formula C28H20N4O3 and a molecular weight of 460.49 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methyl-2-phenylquinoline-4-carboxylate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 135765570 |
| Molecular Formula | C28H20N4O3 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)OC/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H20N4O3/c1-17-25(19-11-5-6-12-21(19)30-26(17)18-9-3-2-4-10-18)28(34)35-16-24(33)20(15-29)27-31-22-13-7-8-14-23(22)32-27/h2-14,33H,16H2,1H3,(H,31,32)/b24-20- |
| InChIKey | TZNPZUQPLRGVME-GFMRDNFCSA-N |
| XLogP | 5.74 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|