C26H22N4O3 — CID 135910831
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 135910831) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 135910831 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | C[C@H]1CCc2nc3ccccc3c(C(=O)OCC(O)=C(C#N)c3nc4ccccc4[nH]3)c2C1 |
| InChI | InChI=1S/C26H22N4O3/c1-15-10-11-20-17(12-15)24(16-6-2-3-7-19(16)28-20)26(32)33-14-23(31)18(13-27)25-29-21-8-4-5-9-22(21)30-25/h2-9,15,31H,10-12,14H2,1H3,(H,29,30)/t15-/m0/s1 |
| InChIKey | IFGDJOJZAOBLAU-HNNXBMFYSA-N |
| XLogP | 4.89 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|