C24H18N4O3 — CID 135744677
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate (PubChem CID 135744677) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 135744677 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylate |
| SMILES | N#C/C(=C(/O)COC(=O)c1c2c(nc3ccccc13)CCC2)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H18N4O3/c25-12-16(23-27-19-9-3-4-10-20(19)28-23)21(29)13-31-24(30)22-14-6-1-2-8-17(14)26-18-11-5-7-15(18)22/h1-4,6,8-10,29H,5,7,11,13H2,(H,27,28)/b21-16- |
| InChIKey | OXKZKMOXHKTCNU-PGMHBOJBSA-N |
| XLogP | 4.25 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|