C21H14N4O4 — CID 135596701
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-oxo-1H-quinoline-2-carboxylate (PubChem CID 135596701) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-oxo-1H-quinoline-2-carboxylate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-oxo-1H-quinoline-2-carboxylate |
|---|---|
| PubChem CID | 135596701 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-oxo-1H-quinoline-2-carboxylate |
| SMILES | N#C/C(=C(/O)COC(=O)c1cc(=O)c2ccccc2[nH]1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H14N4O4/c22-10-13(20-24-15-7-3-4-8-16(15)25-20)19(27)11-29-21(28)17-9-18(26)12-5-1-2-6-14(12)23-17/h1-9,27H,11H2,(H,23,26)(H,24,25)/b19-13- |
| InChIKey | VLRUYSULYMTLAE-UYRXBGFRSA-N |
| XLogP | 3.05 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|