C22H15N3O5 — CID 3347920
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 3347920) has the molecular formula C22H15N3O5 and a molecular weight of 401.38 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 3347920 |
| Molecular Formula | C22H15N3O5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | N#CC(=C(O)COC(=O)c1cc(O)c2ccccc2c1O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H15N3O5/c23-10-15(21-24-16-7-3-4-8-17(16)25-21)19(27)11-30-22(29)14-9-18(26)12-5-1-2-6-13(12)20(14)28/h1-9,26-28H,11H2,(H,24,25) |
| InChIKey | GMBZZGNKMUSDOK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|