C18H11ClN4O5 — CID 5121446
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-4-nitrobenzoate (PubChem CID 5121446) has the molecular formula C18H11ClN4O5 and a molecular weight of 398.76 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 5121446 |
| Molecular Formula | C18H11ClN4O5 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-4-nitrobenzoate |
| SMILES | N#CC(=C(O)COC(=O)c1ccc([N+](=O)[O-])cc1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H11ClN4O5/c19-13-7-10(23(26)27)5-6-11(13)18(25)28-9-16(24)12(8-20)17-21-14-3-1-2-4-15(14)22-17/h1-7,24H,9H2,(H,21,22) |
| InChIKey | YYQKBOGMPWBNDY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|