C20H14ClN5O6 — CID 2480961
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 2480961) has the molecular formula C20H14ClN5O6 and a molecular weight of 455.81 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2480961 |
| Molecular Formula | C20H14ClN5O6 |
| Molecular Weight | 455.81 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | N#CC(=C(O)COC(=O)CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H14ClN5O6/c21-13-6-5-11(7-16(13)26(30)31)20(29)23-9-18(28)32-10-17(27)12(8-22)19-24-14-3-1-2-4-15(14)25-19/h1-7,27H,9-10H2,(H,23,29)(H,24,25) |
| InChIKey | JNEYFUXGQWQWRG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 171.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|