C24H15ClN4O6 — CID 137300440
[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(4-chloro-2-nitrophenoxy)benzoate (PubChem CID 137300440) has the molecular formula C24H15ClN4O6 and a molecular weight of 490.86 g/mol. Its IUPAC name is [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(4-chloro-2-nitrophenoxy)benzoate.
| Compound Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(4-chloro-2-nitrophenoxy)benzoate |
|---|---|
| PubChem CID | 137300440 |
| Molecular Formula | C24H15ClN4O6 |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-(4-chloro-2-nitrophenoxy)benzoate |
| SMILES | N#C/C(=C(\O)COC(=O)c1ccc(Oc2ccc(Cl)cc2[N+](=O)[O-])cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H15ClN4O6/c25-15-7-10-22(20(11-15)29(32)33)35-16-8-5-14(6-9-16)24(31)34-13-21(30)17(12-26)23-27-18-3-1-2-4-19(18)28-23/h1-11,30H,13H2,(H,27,28)/b21-17+ |
| InChIKey | ZPXABKDOUOPQAU-HEHNFIMWSA-N |
| XLogP | 5.57 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|